CAS 1231955-78-4 is the registry number for 5-Methyl-6-morpholinopyridin-3-ylboronic acidhydrochloride, 95%. Offered by: Fluorochem. Available pack sizes: 1g.
(5-methyl-6-morpholin-4-yl-3-pyridinyl)boronic acid;hydrochloride (CAS 1231955-78-4) is a chemical compound with the molecular formula C10H16BClN2O3 and a molecular weight of 258.51 g/mol. IUPAC name: (5-methyl-6-morpholin-4-yl-3-pyridinyl)boronic acid;hydrochloride. InChIKey: IIFFJYFVBBCWCK-UHFFFAOYSA-N.
| Molecular formula | C10H16BClN2O3 |
|---|---|
| Molecular weight | 258.51 g/mol |
| IUPAC name | (5-methyl-6-morpholin-4-yl-3-pyridinyl)boronic acid;hydrochloride |
| InChIKey | IIFFJYFVBBCWCK-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(N=C1)N2CCOCC2)C)(O)O.Cl |
Computed by PubChem (NCBI)