CAS 1231967-34-2 is the registry number for 1-{((3-Fluorophenyl)methyl)(methyl)carbamoyl}-3-methyl-1H-imidazol-3-ium iodide. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
N-[(3-fluorophenyl)methyl]-N,3-dimethylimidazol-3-ium-1-carboxamide iodide (CAS 1231967-34-2) is a chemical compound with the molecular formula C13H15FIN3O and a molecular weight of 375.18 g/mol. IUPAC name: N-[(3-fluorophenyl)methyl]-N,3-dimethylimidazol-3-ium-1-carboxamide iodide. InChIKey: OYHNWAVKFYLNBT-UHFFFAOYSA-M.
| Molecular formula | C13H15FIN3O |
|---|---|
| Molecular weight | 375.18 g/mol |
| IUPAC name | N-[(3-fluorophenyl)methyl]-N,3-dimethylimidazol-3-ium-1-carboxamide iodide |
| InChIKey | OYHNWAVKFYLNBT-UHFFFAOYSA-M |
| SMILES | C[N+]1=CN(C=C1)C(=O)N(C)CC2=CC(=CC=C2)F.[I-] |
Computed by PubChem (NCBI)