CAS 1232061-15-2 appears in our catalog under these names: (S)-N-Methyl-n-(pyrrolidin-3-yl)methanesulfonamide, 95%, (S)-N-Methyl-N-(pyrrolidin-3-yl)methanesulfonamide, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g.
N-methyl-N-[(3S)-pyrrolidin-3-yl]methanesulfonamide (CAS 1232061-15-2) is a chemical compound with the molecular formula C6H14N2O2S and a molecular weight of 178.26 g/mol. IUPAC name: N-methyl-N-[(3S)-pyrrolidin-3-yl]methanesulfonamide. InChIKey: LBWOLXIOYYVGSI-LURJTMIESA-N.
| Molecular formula | C6H14N2O2S |
|---|---|
| Molecular weight | 178.26 g/mol |
| IUPAC name | N-methyl-N-[(3S)-pyrrolidin-3-yl]methanesulfonamide |
| InChIKey | LBWOLXIOYYVGSI-LURJTMIESA-N |
| SMILES | CN([C@H]1CCNC1)S(=O)(=O)C |
Computed by PubChem (NCBI)