Products 123215-05-4
CAS 123215-05-4 is the registry number for LY 189332. Offered by: MedChemExpress. Available pack sizes: Get quote.
N-(4-fluorophenyl)-3,4-bis(4-methoxyphenyl)aniline (CAS 123215-05-4) is a chemical compound with the molecular formula C26H22FNO2 and a molecular weight of 399.5 g/mol. IUPAC name: N-(4-fluorophenyl)-3,4-bis(4-methoxyphenyl)aniline. InChIKey: YLYHJGWVEDCCMX-UHFFFAOYSA-N.
| Molecular formula | C26H22FNO2 |
|---|---|
| Molecular weight | 399.5 g/mol |
| IUPAC name | N-(4-fluorophenyl)-3,4-bis(4-methoxyphenyl)aniline |
| InChIKey | YLYHJGWVEDCCMX-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C2=C(C=C(C=C2)NC3=CC=C(C=C3)F)C4=CC=C(C=C4)OC |
Computed by PubChem (NCBI)