Products 123221-93-2

CAS 123221-93-2 appears in our catalog under these names: 5-Bromo-2-hydroxybenzenesulfonyl chloride, 98%, 5-Bromo-2-hydroxybenzenesulfonyl chloride, 95%, 5-Bromo-2-hydroxybenzenesulfonyl chloride, 95%, 95%. Offered by: AmBeed, Fluorochem, Chemat. Available pack sizes: 10g, 5g, 1g, 100mg, 250mg, 500mg.

Structural formula: {0} (CAS {1})

5-bromo-2-hydroxybenzenesulfonyl chloride (CAS 123221-93-2) is a chemical compound with the molecular formula C6H4BrClO3S and a molecular weight of 271.52 g/mol. IUPAC name: 5-bromo-2-hydroxybenzenesulfonyl chloride. InChIKey: IVDBOZWASCNFKJ-UHFFFAOYSA-N.

Identity
Molecular formulaC6H4BrClO3S
Molecular weight271.52 g/mol
IUPAC name5-bromo-2-hydroxybenzenesulfonyl chloride
InChIKeyIVDBOZWASCNFKJ-UHFFFAOYSA-N
SMILESC1=CC(=C(C=C1Br)S(=O)(=O)Cl)O

Computed by PubChem (NCBI)