CAS 1232431-02-5 is the registry number for 2-Amino-3-bromo-4,5-dichloropyridine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 100mg, 250mg.
3-bromo-4,5-dichloropyridin-2-amine (CAS 1232431-02-5) is a chemical compound with the molecular formula C5H3BrCl2N2 and a molecular weight of 241.90 g/mol. IUPAC name: 3-bromo-4,5-dichloropyridin-2-amine. InChIKey: MZFWOSBWGZFUNL-UHFFFAOYSA-N.
| Molecular formula | C5H3BrCl2N2 |
|---|---|
| Molecular weight | 241.90 g/mol |
| IUPAC name | 3-bromo-4,5-dichloropyridin-2-amine |
| InChIKey | MZFWOSBWGZFUNL-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=N1)N)Br)Cl)Cl |
Computed by PubChem (NCBI)