CAS 123253-97-4 is the registry number for 2-((1,3-Dihydro-1,3-dioxo-2H-isoindol-2-yl)acetyl)-butanedioic-2-13C Acid Diethyl Ester. Offered by: TRC. Available pack sizes: 1mg, 2,5mg, 5mg.
Diethyl 2-[2-(1,3-dioxoisoindol-2-yl)acetyl](213C)butanedioate (CAS 123253-97-4) is a chemical compound with the molecular formula C18H19NO7 and a molecular weight of 362.3 g/mol. IUPAC name: diethyl 2-[2-(1,3-dioxoisoindol-2-yl)acetyl](213C)butanedioate. InChIKey: DUNQNARRQZDSNR-KCKQSJSWSA-N.
| Molecular formula | C18H19NO7 |
|---|---|
| Molecular weight | 362.3 g/mol |
| IUPAC name | diethyl 2-[2-(1,3-dioxoisoindol-2-yl)acetyl](213C)butanedioate |
| InChIKey | DUNQNARRQZDSNR-KCKQSJSWSA-N |
| SMILES | CCOC(=O)C[13CH](C(=O)CN1C(=O)C2=CC=CC=C2C1=O)C(=O)OCC |
Computed by PubChem (NCBI)