Products 125428-01-5

CAS 125428-01-5 is the registry number for 2-((1,3-Dihydro-1,3-dioxo-2H-isoindol-2-yl)acetyl)-butanedioic Acid Diethyl Ester. Offered by: TRC. Available pack sizes: 1mg, 2,5mg, 5mg.

Structural formula: {0} (CAS {1})

Diethyl 2-[2-(1,3-dioxoisoindol-2-yl)acetyl]butanedioate (CAS 125428-01-5) is a chemical compound with the molecular formula C18H19NO7 and a molecular weight of 361.3 g/mol. IUPAC name: diethyl 2-[2-(1,3-dioxoisoindol-2-yl)acetyl]butanedioate. InChIKey: DUNQNARRQZDSNR-UHFFFAOYSA-N.

Identity
Molecular formulaC18H19NO7
Molecular weight361.3 g/mol
IUPAC namediethyl 2-[2-(1,3-dioxoisoindol-2-yl)acetyl]butanedioate
InChIKeyDUNQNARRQZDSNR-UHFFFAOYSA-N
SMILESCCOC(=O)CC(C(=O)CN1C(=O)C2=CC=CC=C2C1=O)C(=O)OCC

Computed by PubChem (NCBI)