CAS 123254-02-4 is the registry number for Meldrum’s Acid 5-13C. Offered by: TRC. Available pack sizes: 25mg, 50mg, 5mg.
2,2-dimethyl-(513C)1,3-dioxane-4,6-dione (CAS 123254-02-4) is a chemical compound with the molecular formula C6H8O4 and a molecular weight of 145.12 g/mol. IUPAC name: 2,2-dimethyl-(513C)1,3-dioxane-4,6-dione. InChIKey: GXHFUVWIGNLZSC-LBPDFUHNSA-N.
| Molecular formula | C6H8O4 |
|---|---|
| Molecular weight | 145.12 g/mol |
| IUPAC name | 2,2-dimethyl-(513C)1,3-dioxane-4,6-dione |
| InChIKey | GXHFUVWIGNLZSC-LBPDFUHNSA-N |
| SMILES | CC1(OC(=O)[13CH2]C(=O)O1)C |
Computed by PubChem (NCBI)