CAS 1232803-45-0 appears in our catalog under these names: 1-(3,5-Difluorophenyl)-5-(1h-pyrrol-1-yl)-1h-pyrazole-4-carboxylic acid, 95%, 1-(3,5-Difluorophenyl)-5-(1H-pyrrol-1-yl)-1H-pyrazole-4-carboxylic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
1-(3,5-difluorophenyl)-5-pyrrol-1-ylpyrazole-4-carboxylic acid (CAS 1232803-45-0) is a chemical compound with the molecular formula C14H9F2N3O2 and a molecular weight of 289.24 g/mol. IUPAC name: 1-(3,5-difluorophenyl)-5-pyrrol-1-ylpyrazole-4-carboxylic acid. InChIKey: HRYDUVXXKZFSKX-UHFFFAOYSA-N.
| Molecular formula | C14H9F2N3O2 |
|---|---|
| Molecular weight | 289.24 g/mol |
| IUPAC name | 1-(3,5-difluorophenyl)-5-pyrrol-1-ylpyrazole-4-carboxylic acid |
| InChIKey | HRYDUVXXKZFSKX-UHFFFAOYSA-N |
| SMILES | C1=CN(C=C1)C2=C(C=NN2C3=CC(=CC(=C3)F)F)C(=O)O |
Computed by PubChem (NCBI)