CAS 1232815-49-4 is the registry number for Pyrrolo[2,1-f][1,2,4]triazin-4(1h)-one, 2,3-dihydro-2-thioxo-, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2-sulfanylidene-1H-pyrrolo[2,1-f][1,2,4]triazin-4-one (CAS 1232815-49-4) is a chemical compound with the molecular formula C6H5N3OS and a molecular weight of 167.19 g/mol. IUPAC name: 2-sulfanylidene-1H-pyrrolo[2,1-f][1,2,4]triazin-4-one. InChIKey: LJVGPQVQNTZJLD-UHFFFAOYSA-N.
| Molecular formula | C6H5N3OS |
|---|---|
| Molecular weight | 167.19 g/mol |
| IUPAC name | 2-sulfanylidene-1H-pyrrolo[2,1-f][1,2,4]triazin-4-one |
| InChIKey | LJVGPQVQNTZJLD-UHFFFAOYSA-N |
| SMILES | C1=CN2C(=C1)C(=O)NC(=S)N2 |
Computed by PubChem (NCBI)