Products 123291-07-6
CAS 123291-07-6 is the registry number for (Rac)-Sezolamide. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-(2-methylpropylamino)-7,7-dioxo-5,6-dihydro-4H-thieno[2,3-b]thiopyran-2-sulfonamide (CAS 123291-07-6) is a chemical compound with the molecular formula C11H18N2O4S3 and a molecular weight of 338.5 g/mol. IUPAC name: 4-(2-methylpropylamino)-7,7-dioxo-5,6-dihydro-4H-thieno[2,3-b]thiopyran-2-sulfonamide. InChIKey: JFLUCCKXAYBETQ-UHFFFAOYSA-N.
| Molecular formula | C11H18N2O4S3 |
|---|---|
| Molecular weight | 338.5 g/mol |
| IUPAC name | 4-(2-methylpropylamino)-7,7-dioxo-5,6-dihydro-4H-thieno[2,3-b]thiopyran-2-sulfonamide |
| InChIKey | JFLUCCKXAYBETQ-UHFFFAOYSA-N |
| SMILES | CC(C)CNC1CCS(=O)(=O)C2=C1C=C(S2)S(=O)(=O)N |
Computed by PubChem (NCBI)
Synonyms:
(+-)-isomer of sezolamide, orb1738307