Products 1233086-48-0

CAS 1233086-48-0 is the registry number for Dibenzyl 5-((diethoxyphosphoryl)methyl)-1H-indole-1,2-dicarboxylate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Dibenzyl 5-(diethoxyphosphorylmethyl)indole-1,2-dicarboxylate (CAS 1233086-48-0) is a chemical compound with the molecular formula C29H30NO7P and a molecular weight of 535.5 g/mol. IUPAC name: dibenzyl 5-(diethoxyphosphorylmethyl)indole-1,2-dicarboxylate. InChIKey: KQNAREZPBYQUQI-UHFFFAOYSA-N.

Identity
Molecular formulaC29H30NO7P
Molecular weight535.5 g/mol
IUPAC namedibenzyl 5-(diethoxyphosphorylmethyl)indole-1,2-dicarboxylate
InChIKeyKQNAREZPBYQUQI-UHFFFAOYSA-N
SMILESCCOP(=O)(CC1=CC2=C(C=C1)N(C(=C2)C(=O)OCC3=CC=CC=C3)C(=O)OCC4=CC=CC=C4)OCC

Computed by PubChem (NCBI)