Products 1233123-61-9
CAS 1233123-61-9 is the registry number for 2-Dimethylamino-4,6-dimethyl-nicotinonitrile, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
2-(dimethylamino)-4,6-dimethylpyridine-3-carbonitrile (CAS 1233123-61-9) is a chemical compound with the molecular formula C10H13N3 and a molecular weight of 175.23 g/mol. IUPAC name: 2-(dimethylamino)-4,6-dimethylpyridine-3-carbonitrile. InChIKey: YIDHWIHHQHGZLY-UHFFFAOYSA-N.
| Molecular formula | C10H13N3 |
|---|---|
| Molecular weight | 175.23 g/mol |
| IUPAC name | 2-(dimethylamino)-4,6-dimethylpyridine-3-carbonitrile |
| InChIKey | YIDHWIHHQHGZLY-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC(=C1C#N)N(C)C)C |
Computed by PubChem (NCBI)