Products 1233219-11-8
CAS 1233219-11-8 is the registry number for Aladorian (sodium). Offered by: MedChemExpress. Available pack sizes: Get quote.
Sodium 2-(7-methoxy-3,5-dihydro-2H-1,4-benzothiazepin-4-yl)-2-oxoacetate (CAS 1233219-11-8) is a chemical compound with the molecular formula C12H12NNaO4S and a molecular weight of 289.28 g/mol. IUPAC name: sodium 2-(7-methoxy-3,5-dihydro-2H-1,4-benzothiazepin-4-yl)-2-oxoacetate. InChIKey: OUNBYSZUAWDKLT-UHFFFAOYSA-M.
| Molecular formula | C12H12NNaO4S |
|---|---|
| Molecular weight | 289.28 g/mol |
| IUPAC name | sodium 2-(7-methoxy-3,5-dihydro-2H-1,4-benzothiazepin-4-yl)-2-oxoacetate |
| InChIKey | OUNBYSZUAWDKLT-UHFFFAOYSA-M |
| SMILES | COC1=CC2=C(C=C1)SCCN(C2)C(=O)C(=O)[O-].[Na+] |
Computed by PubChem (NCBI)