CAS 123333-70-0 appears in our catalog under these names: Sodium sulfanilate hydrate, 96%, Sulfanilic acid sodium salt hydrate, Sodium Sulfanilate Hydrate, >98.0%(HPLC)(T), Sodium Sulfanilate Hydrate [for Biochemical Research], >98.0%(T), Sodium sulfanilate hydrate, 97%. Offered by: Combi-blocks, GLPBio, TCI, Thermo Scientific (Acros), Sigma-Aldrich. Available pack sizes: 500g, 25g, 1kg, 100g, 5g, 250g.
Sodium;4-aminobenzenesulfonate;hydrate (CAS 123333-70-0) is a chemical compound with the molecular formula C6H8NNaO4S and a molecular weight of 213.19 g/mol. IUPAC name: sodium;4-aminobenzenesulfonate;hydrate. InChIKey: VDGKZGAQOPUDQL-UHFFFAOYSA-M.
| Molecular formula | C6H8NNaO4S |
|---|---|
| Molecular weight | 213.19 g/mol |
| IUPAC name | sodium;4-aminobenzenesulfonate;hydrate |
| InChIKey | VDGKZGAQOPUDQL-UHFFFAOYSA-M |
| SMILES | C1=CC(=CC=C1N)S(=O)(=O)[O-].O.[Na+] |
Computed by PubChem (NCBI)