CAS 1233484-06-4 is the registry number for Crizotinib Impurity 2. Offered by: Chemat Brand. Available pack sizes: on request.
3-[(1S)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]-2-nitropyridine (CAS 1233484-06-4) is a chemical compound with the molecular formula C13H9Cl2FN2O3 and a molecular weight of 331.12 g/mol. IUPAC name: 3-[(1S)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]-2-nitropyridine. InChIKey: VGDOUCIQKWTGJY-ZETCQYMHSA-N.
| Molecular formula | C13H9Cl2FN2O3 |
|---|---|
| Molecular weight | 331.12 g/mol |
| IUPAC name | 3-[(1S)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]-2-nitropyridine |
| InChIKey | VGDOUCIQKWTGJY-ZETCQYMHSA-N |
| SMILES | C[C@@H](C1=C(C=CC(=C1Cl)F)Cl)OC2=C(N=CC=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)