CAS 1233505-70-8 is the registry number for Sodium 4–bromo–2–chlorobenzenesulfinate. Offered by: GLPBio. Available pack sizes: 100mg, 1g, 2,5g, 250mg, 50mg, 500mg.
Sodium 4-bromo-2-chlorobenzenesulfinate (CAS 1233505-70-8) is a chemical compound with the molecular formula C6H3BrClNaO2S and a molecular weight of 277.50 g/mol. IUPAC name: sodium 4-bromo-2-chlorobenzenesulfinate. InChIKey: IPXXNUWIAORJIN-UHFFFAOYSA-M.
| Molecular formula | C6H3BrClNaO2S |
|---|---|
| Molecular weight | 277.50 g/mol |
| IUPAC name | sodium 4-bromo-2-chlorobenzenesulfinate |
| InChIKey | IPXXNUWIAORJIN-UHFFFAOYSA-M |
| SMILES | C1=CC(=C(C=C1Br)Cl)S(=O)[O-].[Na+] |
Computed by PubChem (NCBI)