CAS 1233520-90-5 is the registry number for Sodium 2,4-dichlorobenzene-1-sulfinate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Sodium 2,4-dichlorobenzenesulfinate (CAS 1233520-90-5) is a chemical compound with the molecular formula C6H3Cl2NaO2S and a molecular weight of 233.05 g/mol. IUPAC name: sodium 2,4-dichlorobenzenesulfinate. InChIKey: QMCRYCDKXNPDAT-UHFFFAOYSA-M.
| Molecular formula | C6H3Cl2NaO2S |
|---|---|
| Molecular weight | 233.05 g/mol |
| IUPAC name | sodium 2,4-dichlorobenzenesulfinate |
| InChIKey | QMCRYCDKXNPDAT-UHFFFAOYSA-M |
| SMILES | C1=CC(=C(C=C1Cl)Cl)S(=O)[O-].[Na+] |
Computed by PubChem (NCBI)