CAS 123375-94-0 appears in our catalog under these names: Flunarizine N-Oxide, Flunarizine Impurity 1, Flunarizine Impurity 5, 4-(bis(4-Fluorophenyl)methyl)-1-cinnamylpiperazine 1-Oxide. Offered by: Chemat Brand, Hubei YoungXin, TRC. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
4-[bis(4-fluorophenyl)methyl]-1-oxido-1-[(E)-3-phenylprop-2-enyl]piperazin-1-ium (CAS 123375-94-0) is a chemical compound with the molecular formula C26H26F2N2O and a molecular weight of 420.5 g/mol. IUPAC name: 4-[bis(4-fluorophenyl)methyl]-1-oxido-1-[(E)-3-phenylprop-2-enyl]piperazin-1-ium. InChIKey: CFOFJASKAOBSRJ-QPJJXVBHSA-N.
| Molecular formula | C26H26F2N2O |
|---|---|
| Molecular weight | 420.5 g/mol |
| IUPAC name | 4-[bis(4-fluorophenyl)methyl]-1-oxido-1-[(E)-3-phenylprop-2-enyl]piperazin-1-ium |
| InChIKey | CFOFJASKAOBSRJ-QPJJXVBHSA-N |
| SMILES | C1C[N+](CCN1C(C2=CC=C(C=C2)F)C3=CC=C(C=C3)F)(C/C=C/C4=CC=CC=C4)[O-] |
Computed by PubChem (NCBI)