CAS 1233836-95-7 is the registry number for Sodium (fluorosulfonyl)((trifluoromethyl)sulfonyl)amide, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Sodium fluorosulfonyl(trifluoromethylsulfonyl)azanide (CAS 1233836-95-7) is a chemical compound with the molecular formula CF4NNaO4S2 and a molecular weight of 253.13 g/mol. IUPAC name: sodium fluorosulfonyl(trifluoromethylsulfonyl)azanide. InChIKey: LCHGIUYYRDGLGA-UHFFFAOYSA-N.
| Molecular formula | CF4NNaO4S2 |
|---|---|
| Molecular weight | 253.13 g/mol |
| IUPAC name | sodium fluorosulfonyl(trifluoromethylsulfonyl)azanide |
| InChIKey | LCHGIUYYRDGLGA-UHFFFAOYSA-N |
| SMILES | C(F)(F)(F)S(=O)(=O)[N-]S(=O)(=O)F.[Na+] |
Computed by PubChem (NCBI)