CAS 1233953-03-1 is the registry number for 1-BOC-4-benzenesulfonamidopiperidine, 96%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
Tert-butyl 4-(benzenesulfonamido)piperidine-1-carboxylate (CAS 1233953-03-1) is a chemical compound with the molecular formula C16H24N2O4S and a molecular weight of 340.4 g/mol. IUPAC name: tert-butyl 4-(benzenesulfonamido)piperidine-1-carboxylate. InChIKey: YWLMTFLSICVBFN-UHFFFAOYSA-N.
| Molecular formula | C16H24N2O4S |
|---|---|
| Molecular weight | 340.4 g/mol |
| IUPAC name | tert-butyl 4-(benzenesulfonamido)piperidine-1-carboxylate |
| InChIKey | YWLMTFLSICVBFN-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(CC1)NS(=O)(=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)