CAS 1233954-89-6 is the registry number for tert-Butyl 4-(3-aminophenylsulfonamido)piperidine-1-carboxylate, 95+%. Offered by: AmBeed. Available pack sizes: 1g.
Tert-butyl 4-[(3-aminophenyl)sulfonylamino]piperidine-1-carboxylate (CAS 1233954-89-6) is a chemical compound with the molecular formula C16H25N3O4S and a molecular weight of 355.5 g/mol. IUPAC name: tert-butyl 4-[(3-aminophenyl)sulfonylamino]piperidine-1-carboxylate. InChIKey: COOFCDNAEJYSTF-UHFFFAOYSA-N.
| Molecular formula | C16H25N3O4S |
|---|---|
| Molecular weight | 355.5 g/mol |
| IUPAC name | tert-butyl 4-[(3-aminophenyl)sulfonylamino]piperidine-1-carboxylate |
| InChIKey | COOFCDNAEJYSTF-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(CC1)NS(=O)(=O)C2=CC=CC(=C2)N |
Computed by PubChem (NCBI)