CAS 1233954-95-4 appears in our catalog under these names: 1-(3-Fluoro-2-nitrophenyl)piperidin-4-amine hydrochloride, 95%, 1-(3-Fluoro-2-nitrophenyl)piperidin-4-amine hydrochloride, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 100mg.
1-(3-fluoro-2-nitrophenyl)piperidin-4-amine;hydrochloride (CAS 1233954-95-4) is a chemical compound with the molecular formula C11H15ClFN3O2 and a molecular weight of 275.71 g/mol. IUPAC name: 1-(3-fluoro-2-nitrophenyl)piperidin-4-amine;hydrochloride. InChIKey: LEHHNNVWFHXCDB-UHFFFAOYSA-N.
| Molecular formula | C11H15ClFN3O2 |
|---|---|
| Molecular weight | 275.71 g/mol |
| IUPAC name | 1-(3-fluoro-2-nitrophenyl)piperidin-4-amine;hydrochloride |
| InChIKey | LEHHNNVWFHXCDB-UHFFFAOYSA-N |
| SMILES | C1CN(CCC1N)C2=C(C(=CC=C2)F)[N+](=O)[O-].Cl |
Computed by PubChem (NCBI)