CAS 1233958-41-2 appears in our catalog under these names: 3-[1-(tert-Butoxycarbonyl)piperidin-4-ylaminosulfonyl]benzoic acid, 95%, 3-(1-(tert-Butoxycarbonyl)piperidin-4-ylaminosulfonyl)benzoic acid, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 100mg.
3-[[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]sulfamoyl]benzoic acid (CAS 1233958-41-2) is a chemical compound with the molecular formula C17H24N2O6S and a molecular weight of 384.4 g/mol. IUPAC name: 3-[[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]sulfamoyl]benzoic acid. InChIKey: NLZAUVATRLPSHA-UHFFFAOYSA-N.
| Molecular formula | C17H24N2O6S |
|---|---|
| Molecular weight | 384.4 g/mol |
| IUPAC name | 3-[[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]sulfamoyl]benzoic acid |
| InChIKey | NLZAUVATRLPSHA-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(CC1)NS(=O)(=O)C2=CC=CC(=C2)C(=O)O |
Computed by PubChem (NCBI)