CAS 1234064-11-9 appears in our catalog under these names: 4-(2-Aminoethyl)-6-chloro-7-hydroxy-2H-1-benzopyran-2-one 2,2,2-trifluoroacetate, 98%, FFN-102 (trifluoroacetate salt), FFN–102 (trifluoroacetate salt), FFN102, FFN-102 (trifluoroacetate). Offered by: Chemat Brand, TargetMol, GLPBio, Biosynth, MedChemExpress. Available pack sizes: on request, 5mg, 10mg, 1mg, 25mg, 50mg, 100mg, 5 mg.
4-(2-aminoethyl)-6-chloro-7-hydroxychromen-2-one;2,2,2-trifluoroacetic acid (CAS 1234064-11-9) is a chemical compound with the molecular formula C13H11ClF3NO5 and a molecular weight of 353.68 g/mol. IUPAC name: 4-(2-aminoethyl)-6-chloro-7-hydroxychromen-2-one;2,2,2-trifluoroacetic acid. InChIKey: OGHPXKAKVMJGQH-UHFFFAOYSA-N.
| Molecular formula | C13H11ClF3NO5 |
|---|---|
| Molecular weight | 353.68 g/mol |
| IUPAC name | 4-(2-aminoethyl)-6-chloro-7-hydroxychromen-2-one;2,2,2-trifluoroacetic acid |
| InChIKey | OGHPXKAKVMJGQH-UHFFFAOYSA-N |
| SMILES | C1=C(C2=CC(=C(C=C2OC1=O)O)Cl)CCN.C(=O)(C(F)(F)F)O |
Computed by PubChem (NCBI)