CAS 123418-41-7 is the registry number for Boc-L-Tyr(3,5-Cl2)-OH. Offered by: Iris Biotech. Available pack sizes: 250mg, 1g.
(2S)-3-(3,5-dichloro-4-hydroxyphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 123418-41-7) is a chemical compound with the molecular formula C14H17Cl2NO5 and a molecular weight of 350.2 g/mol. IUPAC name: (2S)-3-(3,5-dichloro-4-hydroxyphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: GRNLRGVZPAASPS-JTQLQIEISA-N.
| Molecular formula | C14H17Cl2NO5 |
|---|---|
| Molecular weight | 350.2 g/mol |
| IUPAC name | (2S)-3-(3,5-dichloro-4-hydroxyphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | GRNLRGVZPAASPS-JTQLQIEISA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC1=CC(=C(C(=C1)Cl)O)Cl)C(=O)O |
Computed by PubChem (NCBI)