CAS 1234190-22-7 is the registry number for (2S) 4-Methyl-2-(propane-2-sulfonylamino)-pentanoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
(2S)-4-methyl-2-(propan-2-ylsulfonylamino)pentanoic acid (CAS 1234190-22-7) is a chemical compound with the molecular formula C9H19NO4S and a molecular weight of 237.32 g/mol. IUPAC name: (2S)-4-methyl-2-(propan-2-ylsulfonylamino)pentanoic acid. InChIKey: CRTCYKQKRXRQEF-QMMMGPOBSA-N.
| Molecular formula | C9H19NO4S |
|---|---|
| Molecular weight | 237.32 g/mol |
| IUPAC name | (2S)-4-methyl-2-(propan-2-ylsulfonylamino)pentanoic acid |
| InChIKey | CRTCYKQKRXRQEF-QMMMGPOBSA-N |
| SMILES | CC(C)C[C@@H](C(=O)O)NS(=O)(=O)C(C)C |
Computed by PubChem (NCBI)