Products 123437-16-1

CAS 123437-16-1 is the registry number for Coelenterazine F. Offered by: Hubei YoungXin, Biosynth. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, 2mg, 1mg, 5mg.

Structural formula: {0} (CAS {1})

8-benzyl-2-[(4-fluorophenyl)methyl]-6-(4-hydroxyphenyl)imidazo[1,2-a]pyrazin-3-ol (CAS 123437-16-1) is a chemical compound with the molecular formula C26H20FN3O2 and a molecular weight of 425.5 g/mol. IUPAC name: 8-benzyl-2-[(4-fluorophenyl)methyl]-6-(4-hydroxyphenyl)imidazo[1,2-a]pyrazin-3-ol. InChIKey: MEMQQZHHXCOKGG-UHFFFAOYSA-N.

Identity
Molecular formulaC26H20FN3O2
Molecular weight425.5 g/mol
IUPAC name8-benzyl-2-[(4-fluorophenyl)methyl]-6-(4-hydroxyphenyl)imidazo[1,2-a]pyrazin-3-ol
InChIKeyMEMQQZHHXCOKGG-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)CC2=NC(=CN3C2=NC(=C3O)CC4=CC=C(C=C4)F)C5=CC=C(C=C5)O

Computed by PubChem (NCBI)