CAS 123437-16-1 is the registry number for Coelenterazine F. Offered by: Hubei YoungXin, Biosynth. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, 2mg, 1mg, 5mg.
8-benzyl-2-[(4-fluorophenyl)methyl]-6-(4-hydroxyphenyl)imidazo[1,2-a]pyrazin-3-ol (CAS 123437-16-1) is a chemical compound with the molecular formula C26H20FN3O2 and a molecular weight of 425.5 g/mol. IUPAC name: 8-benzyl-2-[(4-fluorophenyl)methyl]-6-(4-hydroxyphenyl)imidazo[1,2-a]pyrazin-3-ol. InChIKey: MEMQQZHHXCOKGG-UHFFFAOYSA-N.
| Molecular formula | C26H20FN3O2 |
|---|---|
| Molecular weight | 425.5 g/mol |
| IUPAC name | 8-benzyl-2-[(4-fluorophenyl)methyl]-6-(4-hydroxyphenyl)imidazo[1,2-a]pyrazin-3-ol |
| InChIKey | MEMQQZHHXCOKGG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC2=NC(=CN3C2=NC(=C3O)CC4=CC=C(C=C4)F)C5=CC=C(C=C5)O |
Computed by PubChem (NCBI)