CAS 1234423-98-3 is the registry number for 3-(6,8-Dichloro-2-methyl-1,2,3,4-tetrahydroisoquinolin-4-yl)benzene-1-sulfonyl chloride, 95+%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(6,8-dichloro-2-methyl-3,4-dihydro-1H-isoquinolin-4-yl)benzenesulfonyl chloride (CAS 1234423-98-3) is a chemical compound with the molecular formula C16H14Cl3NO2S and a molecular weight of 390.7 g/mol. IUPAC name: 3-(6,8-dichloro-2-methyl-3,4-dihydro-1H-isoquinolin-4-yl)benzenesulfonyl chloride. InChIKey: JMSQXKPISJKOJN-UHFFFAOYSA-N.
| Molecular formula | C16H14Cl3NO2S |
|---|---|
| Molecular weight | 390.7 g/mol |
| IUPAC name | 3-(6,8-dichloro-2-methyl-3,4-dihydro-1H-isoquinolin-4-yl)benzenesulfonyl chloride |
| InChIKey | JMSQXKPISJKOJN-UHFFFAOYSA-N |
| SMILES | CN1CC(C2=C(C1)C(=CC(=C2)Cl)Cl)C3=CC(=CC=C3)S(=O)(=O)Cl |
Computed by PubChem (NCBI)