CAS 1234576-81-8 appears in our catalog under these names: (S)-3-Iodo-pyrrolidine-1-carboxylic acid tert-butyl ester, 95%, (S)–tert–Butyl 3–iodopyrrolidine–1–carboxylate. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 1g, 100mg.
Tert-butyl (3S)-3-iodopyrrolidine-1-carboxylate (CAS 1234576-81-8) is a chemical compound with the molecular formula C9H16INO2 and a molecular weight of 297.13 g/mol. IUPAC name: tert-butyl (3S)-3-iodopyrrolidine-1-carboxylate. InChIKey: CFTPTQLIAIOWLK-ZETCQYMHSA-N.
| Molecular formula | C9H16INO2 |
|---|---|
| Molecular weight | 297.13 g/mol |
| IUPAC name | tert-butyl (3S)-3-iodopyrrolidine-1-carboxylate |
| InChIKey | CFTPTQLIAIOWLK-ZETCQYMHSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC[C@@H](C1)I |
Computed by PubChem (NCBI)