Products 1234616-49-9
CAS 1234616-49-9 is the registry number for 4-Chloro-5-fluoro-2-methyl-7-azaindole, 95%. Offered by: Combi-blocks. Available pack sizes: 500mg, 100mg.
4-chloro-5-fluoro-2-methyl-1H-pyrrolo[2,3-b]pyridine (CAS 1234616-49-9) is a chemical compound with the molecular formula C8H6ClFN2 and a molecular weight of 184.60 g/mol. IUPAC name: 4-chloro-5-fluoro-2-methyl-1H-pyrrolo[2,3-b]pyridine. InChIKey: IUUCGVQZEADVHH-UHFFFAOYSA-N.
| Molecular formula | C8H6ClFN2 |
|---|---|
| Molecular weight | 184.60 g/mol |
| IUPAC name | 4-chloro-5-fluoro-2-methyl-1H-pyrrolo[2,3-b]pyridine |
| InChIKey | IUUCGVQZEADVHH-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C(=CN=C2N1)F)Cl |
Computed by PubChem (NCBI)