CAS 1020035-40-8 is the registry number for 2-(Chloromethyl)-8-fluoroimidazo(1,2-a)pyridine. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-(chloromethyl)-8-fluoroimidazo[1,2-a]pyridine (CAS 1020035-40-8) is a chemical compound with the molecular formula C8H6ClFN2 and a molecular weight of 184.60 g/mol. IUPAC name: 2-(chloromethyl)-8-fluoroimidazo[1,2-a]pyridine. InChIKey: LTMCKRGRXKLJNT-UHFFFAOYSA-N.
| Molecular formula | C8H6ClFN2 |
|---|---|
| Molecular weight | 184.60 g/mol |
| IUPAC name | 2-(chloromethyl)-8-fluoroimidazo[1,2-a]pyridine |
| InChIKey | LTMCKRGRXKLJNT-UHFFFAOYSA-N |
| SMILES | C1=CN2C=C(N=C2C(=C1)F)CCl |
Computed by PubChem (NCBI)