Products 1234789-63-9
CAS 1234789-63-9 is the registry number for (1S)-1-(4-phenoxyphenyl)ethan-1-amine, >95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
(1S)-1-(4-phenoxyphenyl)ethanamine (CAS 1234789-63-9) is a chemical compound with the molecular formula C14H15NO and a molecular weight of 213.27 g/mol. IUPAC name: (1S)-1-(4-phenoxyphenyl)ethanamine. InChIKey: WSQOGHJCBFRHSI-NSHDSACASA-N.
| Molecular formula | C14H15NO |
|---|---|
| Molecular weight | 213.27 g/mol |
| IUPAC name | (1S)-1-(4-phenoxyphenyl)ethanamine |
| InChIKey | WSQOGHJCBFRHSI-NSHDSACASA-N |
| SMILES | C[C@@H](C1=CC=C(C=C1)OC2=CC=CC=C2)N |
Computed by PubChem (NCBI)