CAS 1235-21-8 appears in our catalog under these names: Acetonyltriphenylphosphonium chloride/ 99%, Acetonyltriphenylphosphonium chloride, 99% , Acetonyltriphenylphosphonium Chloride, >98.0%(HPLC)(T), (2-Oxopropyl)triphenylphosphonium chloride, 95%, 95%, Acetonyl triphenylphosphonium chloride, 98%. Offered by: Chemat, Thermo Scientific (Alfa Aesar), TCI, Fluorochem, Ambeed. Available pack sizes: 100g, 25g, 500g, 5g, 1g.
2-oxopropyl(triphenyl)phosphanium chloride (CAS 1235-21-8) is a chemical compound with the molecular formula C21H20ClOP and a molecular weight of 354.8 g/mol. IUPAC name: 2-oxopropyl(triphenyl)phosphanium chloride. InChIKey: XAMZZEBAJZJERT-UHFFFAOYSA-M.
| Molecular formula | C21H20ClOP |
|---|---|
| Molecular weight | 354.8 g/mol |
| IUPAC name | 2-oxopropyl(triphenyl)phosphanium chloride |
| InChIKey | XAMZZEBAJZJERT-UHFFFAOYSA-M |
| SMILES | CC(=O)C[P+](C1=CC=CC=C1)(C2=CC=CC=C2)C3=CC=CC=C3.[Cl-] |
Computed by PubChem (NCBI)