CAS 1235219-21-2 is the registry number for Sulfanilic Acid-d4, >95% (HPLC). Offered by: TRC. Available pack sizes: 100mg, 10mg.
4-amino-2,3,5,6-tetradeuteriobenzenesulfonic acid (CAS 1235219-21-2) is a chemical compound with the molecular formula C6H7NO3S and a molecular weight of 177.22 g/mol. IUPAC name: 4-amino-2,3,5,6-tetradeuteriobenzenesulfonic acid. InChIKey: HVBSAKJJOYLTQU-RHQRLBAQSA-N.
| Molecular formula | C6H7NO3S |
|---|---|
| Molecular weight | 177.22 g/mol |
| IUPAC name | 4-amino-2,3,5,6-tetradeuteriobenzenesulfonic acid |
| InChIKey | HVBSAKJJOYLTQU-RHQRLBAQSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1N)[2H])[2H])S(=O)(=O)O)[2H] |
Computed by PubChem (NCBI)