Products 1235219-21-2

CAS 1235219-21-2 is the registry number for Sulfanilic Acid-d4, >95% (HPLC). Offered by: TRC. Available pack sizes: 100mg, 10mg.

Structural formula: {0} (CAS {1})

4-amino-2,3,5,6-tetradeuteriobenzenesulfonic acid (CAS 1235219-21-2) is a chemical compound with the molecular formula C6H7NO3S and a molecular weight of 177.22 g/mol. IUPAC name: 4-amino-2,3,5,6-tetradeuteriobenzenesulfonic acid. InChIKey: HVBSAKJJOYLTQU-RHQRLBAQSA-N.

Identity
Molecular formulaC6H7NO3S
Molecular weight177.22 g/mol
IUPAC name4-amino-2,3,5,6-tetradeuteriobenzenesulfonic acid
InChIKeyHVBSAKJJOYLTQU-RHQRLBAQSA-N
SMILES[2H]C1=C(C(=C(C(=C1N)[2H])[2H])S(=O)(=O)O)[2H]

Computed by PubChem (NCBI)