CAS 1235234-58-8 is the registry number for 3-Butyl-1-methyl-1H-imidazol-3-ium bis(fluorosulfonyl)amide, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
Bis(fluorosulfonyl)azanide;1-butyl-3-methylimidazol-3-ium (CAS 1235234-58-8) is a chemical compound with the molecular formula C8H15F2N3O4S2 and a molecular weight of 319.4 g/mol. IUPAC name: bis(fluorosulfonyl)azanide;1-butyl-3-methylimidazol-3-ium. InChIKey: UAHSIDZLYHAYDH-UHFFFAOYSA-N.
| Molecular formula | C8H15F2N3O4S2 |
|---|---|
| Molecular weight | 319.4 g/mol |
| IUPAC name | bis(fluorosulfonyl)azanide;1-butyl-3-methylimidazol-3-ium |
| InChIKey | UAHSIDZLYHAYDH-UHFFFAOYSA-N |
| SMILES | CCCCN1C=C[N+](=C1)C.[N-](S(=O)(=O)F)S(=O)(=O)F |
Computed by PubChem (NCBI)