Products 1235234-58-8

CAS 1235234-58-8 is the registry number for 3-Butyl-1-methyl-1H-imidazol-3-ium bis(fluorosulfonyl)amide, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.

Structural formula: {0} (CAS {1})

Bis(fluorosulfonyl)azanide;1-butyl-3-methylimidazol-3-ium (CAS 1235234-58-8) is a chemical compound with the molecular formula C8H15F2N3O4S2 and a molecular weight of 319.4 g/mol. IUPAC name: bis(fluorosulfonyl)azanide;1-butyl-3-methylimidazol-3-ium. InChIKey: UAHSIDZLYHAYDH-UHFFFAOYSA-N.

Identity
Molecular formulaC8H15F2N3O4S2
Molecular weight319.4 g/mol
IUPAC namebis(fluorosulfonyl)azanide;1-butyl-3-methylimidazol-3-ium
InChIKeyUAHSIDZLYHAYDH-UHFFFAOYSA-N
SMILESCCCCN1C=C[N+](=C1)C.[N-](S(=O)(=O)F)S(=O)(=O)F

Computed by PubChem (NCBI)