CAS 1235438-75-1 appears in our catalog under these names: 3,5-Bis(2,2,2-trifluoroethoxy)aniline hydrochloride, 95%, 3,5-Bis(2,2,2-trifluoroethoxy)aniline hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 2,5g, 250mg.
3,5-bis(2,2,2-trifluoroethoxy)aniline;hydrochloride (CAS 1235438-75-1) is a chemical compound with the molecular formula C10H10ClF6NO2 and a molecular weight of 325.63 g/mol. IUPAC name: 3,5-bis(2,2,2-trifluoroethoxy)aniline;hydrochloride. InChIKey: JIYLXBBATSRDRI-UHFFFAOYSA-N.
| Molecular formula | C10H10ClF6NO2 |
|---|---|
| Molecular weight | 325.63 g/mol |
| IUPAC name | 3,5-bis(2,2,2-trifluoroethoxy)aniline;hydrochloride |
| InChIKey | JIYLXBBATSRDRI-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1OCC(F)(F)F)OCC(F)(F)F)N.Cl |
Computed by PubChem (NCBI)