CAS 1235439-34-5 appears in our catalog under these names: (1S)-5-Fluoro-2,3-dihydro-1H-inden-1-ol, 95%, (1S)-5-Fluoro-2,3-dihydro-1H-inden-1-ol. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
(1S)-5-fluoro-2,3-dihydro-1H-inden-1-ol (CAS 1235439-34-5) is a chemical compound with the molecular formula C9H9FO and a molecular weight of 152.16 g/mol. IUPAC name: (1S)-5-fluoro-2,3-dihydro-1H-inden-1-ol. InChIKey: FFJGCSVJFOTPEO-VIFPVBQESA-N.
| Molecular formula | C9H9FO |
|---|---|
| Molecular weight | 152.16 g/mol |
| IUPAC name | (1S)-5-fluoro-2,3-dihydro-1H-inden-1-ol |
| InChIKey | FFJGCSVJFOTPEO-VIFPVBQESA-N |
| SMILES | C1CC2=C([C@H]1O)C=CC(=C2)F |
Computed by PubChem (NCBI)