CAS 1235439-39-0 appears in our catalog under these names: 2,2,2-Trifluoroethyl n-(2-chloro-4-nitrophenyl)carbamate, 95%, 2,2,2-Trifluoroethyl N-(2-chloro-4-nitrophenyl)carbamate. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 0,5g.
2,2,2-trifluoroethyl N-(2-chloro-4-nitrophenyl)carbamate (CAS 1235439-39-0) is a chemical compound with the molecular formula C9H6ClF3N2O4 and a molecular weight of 298.60 g/mol. IUPAC name: 2,2,2-trifluoroethyl N-(2-chloro-4-nitrophenyl)carbamate. InChIKey: OYRSBPWZLVBSIW-UHFFFAOYSA-N.
| Molecular formula | C9H6ClF3N2O4 |
|---|---|
| Molecular weight | 298.60 g/mol |
| IUPAC name | 2,2,2-trifluoroethyl N-(2-chloro-4-nitrophenyl)carbamate |
| InChIKey | OYRSBPWZLVBSIW-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1[N+](=O)[O-])Cl)NC(=O)OCC(F)(F)F |
Computed by PubChem (NCBI)