CAS 1235440-45-5 appears in our catalog under these names: 6,8-Dichloro-2-(chloromethyl)imidazo(1,2-a)pyridine hydrochloride, 95%, 6,8-Dichloro-2-(chloromethyl)imidazo(1,2-a)pyridine hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 2,5g, 250mg.
6,8-dichloro-2-(chloromethyl)imidazo[1,2-a]pyridine;hydrochloride (CAS 1235440-45-5) is a chemical compound with the molecular formula C8H6Cl4N2 and a molecular weight of 272.0 g/mol. IUPAC name: 6,8-dichloro-2-(chloromethyl)imidazo[1,2-a]pyridine;hydrochloride. InChIKey: FFDINBXPZXZKPB-UHFFFAOYSA-N.
| Molecular formula | C8H6Cl4N2 |
|---|---|
| Molecular weight | 272.0 g/mol |
| IUPAC name | 6,8-dichloro-2-(chloromethyl)imidazo[1,2-a]pyridine;hydrochloride |
| InChIKey | FFDINBXPZXZKPB-UHFFFAOYSA-N |
| SMILES | C1=C(C2=NC(=CN2C=C1Cl)CCl)Cl.Cl |
Computed by PubChem (NCBI)