CAS 1235440-73-9 is the registry number for 2,2,2-Trifluoroethyl N-(5-(dimethylsulfamoyl)-2-methoxyphenyl)carbamate. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
2,2,2-trifluoroethyl N-[5-(dimethylsulfamoyl)-2-methoxyphenyl]carbamate (CAS 1235440-73-9) is a chemical compound with the molecular formula C12H15F3N2O5S and a molecular weight of 356.32 g/mol. IUPAC name: 2,2,2-trifluoroethyl N-[5-(dimethylsulfamoyl)-2-methoxyphenyl]carbamate. InChIKey: FRFQTASFAWKKMH-UHFFFAOYSA-N.
| Molecular formula | C12H15F3N2O5S |
|---|---|
| Molecular weight | 356.32 g/mol |
| IUPAC name | 2,2,2-trifluoroethyl N-[5-(dimethylsulfamoyl)-2-methoxyphenyl]carbamate |
| InChIKey | FRFQTASFAWKKMH-UHFFFAOYSA-N |
| SMILES | CN(C)S(=O)(=O)C1=CC(=C(C=C1)OC)NC(=O)OCC(F)(F)F |
Computed by PubChem (NCBI)