CAS 1235441-10-7 appears in our catalog under these names: 3-Hydroxy-4-(piperazin-1-yl)tetrahydrothiophene 1,1-dioxide dihydrochloride, 98%, 1,1-Dioxo-4-piperazin-1-ylthiolan-3-ol dihydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
1,1-dioxo-4-piperazin-1-ylthiolan-3-ol;dihydrochloride (CAS 1235441-10-7) is a chemical compound with the molecular formula C8H18Cl2N2O3S and a molecular weight of 293.21 g/mol. IUPAC name: 1,1-dioxo-4-piperazin-1-ylthiolan-3-ol;dihydrochloride. InChIKey: JMCLJEPUZAFCRH-UHFFFAOYSA-N.
| Molecular formula | C8H18Cl2N2O3S |
|---|---|
| Molecular weight | 293.21 g/mol |
| IUPAC name | 1,1-dioxo-4-piperazin-1-ylthiolan-3-ol;dihydrochloride |
| InChIKey | JMCLJEPUZAFCRH-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)C2CS(=O)(=O)CC2O.Cl.Cl |
Computed by PubChem (NCBI)