CAS 1235475-01-0 appears in our catalog under these names: 2-(2,6-Difluorophenyl)thiazole-5-carbaldehyde, 97%, 2-(2,6-Difluorophenyl)-1,3-thiazole-5-carbaldehyde. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
2-(2,6-difluorophenyl)-1,3-thiazole-5-carbaldehyde (CAS 1235475-01-0) is a chemical compound with the molecular formula C10H5F2NOS and a molecular weight of 225.22 g/mol. IUPAC name: 2-(2,6-difluorophenyl)-1,3-thiazole-5-carbaldehyde. InChIKey: DALGECSTWYGKIY-UHFFFAOYSA-N.
| Molecular formula | C10H5F2NOS |
|---|---|
| Molecular weight | 225.22 g/mol |
| IUPAC name | 2-(2,6-difluorophenyl)-1,3-thiazole-5-carbaldehyde |
| InChIKey | DALGECSTWYGKIY-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)F)C2=NC=C(S2)C=O)F |
Computed by PubChem (NCBI)