Products 1235489-47-0
CAS 1235489-47-0 appears in our catalog under these names: Benzamide-2,3,4,5,6-d5, 99 atom % D, min 98% Chemical Purity, Benzamide-d5. Offered by: CDN, Biosynth, MedChemExpress. Available pack sizes: 0,5g, 0,25g, 500mg, 250mg, 100 mg, 50 mg, 5 mg, 25 mg.
2,3,4,5,6-pentadeuteriobenzamide (CAS 1235489-47-0) is a chemical compound with the molecular formula C7H7NO and a molecular weight of 126.17 g/mol. IUPAC name: 2,3,4,5,6-pentadeuteriobenzamide. InChIKey: KXDAEFPNCMNJSK-RALIUCGRSA-N.
| Molecular formula | C7H7NO |
|---|---|
| Molecular weight | 126.17 g/mol |
| IUPAC name | 2,3,4,5,6-pentadeuteriobenzamide |
| InChIKey | KXDAEFPNCMNJSK-RALIUCGRSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])C(=O)N)[2H])[2H] |
Computed by PubChem (NCBI)
Synonyms:
2,3,4,5,6-pentadeuteriobenzamide, Benzamide-d5