CAS 1235643-62-5 appears in our catalog under these names: (R)-1-(1H-Benzimidazol-2-yl)-3-methylbutylamine hydrochloride, 95%, (R)–1–(1H–Benzimidazol–2–yl)–3–methylbutylamine Hydrochloride. Offered by: Combi-blocks, GLPBio. Available pack sizes: 5g, 1g, 250mg.
(1R)-1-(1H-benzimidazol-2-yl)-3-methylbutan-1-amine;hydrochloride (CAS 1235643-62-5) is a chemical compound with the molecular formula C12H18ClN3 and a molecular weight of 239.74 g/mol. IUPAC name: (1R)-1-(1H-benzimidazol-2-yl)-3-methylbutan-1-amine;hydrochloride. InChIKey: ZXGYOQOVBUHUQG-SBSPUUFOSA-N.
| Molecular formula | C12H18ClN3 |
|---|---|
| Molecular weight | 239.74 g/mol |
| IUPAC name | (1R)-1-(1H-benzimidazol-2-yl)-3-methylbutan-1-amine;hydrochloride |
| InChIKey | ZXGYOQOVBUHUQG-SBSPUUFOSA-N |
| SMILES | CC(C)C[C@H](C1=NC2=CC=CC=C2N1)N.Cl |
Computed by PubChem (NCBI)