CAS 1235963-01-5 is the registry number for 2-Methyl-5-(thiazol-2-yl)phenylboronic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
[2-methyl-5-(1,3-thiazol-2-yl)phenyl]boronic acid (CAS 1235963-01-5) is a chemical compound with the molecular formula C10H10BNO2S and a molecular weight of 219.07 g/mol. IUPAC name: [2-methyl-5-(1,3-thiazol-2-yl)phenyl]boronic acid. InChIKey: VIDCQZUAYXLDEZ-UHFFFAOYSA-N.
| Molecular formula | C10H10BNO2S |
|---|---|
| Molecular weight | 219.07 g/mol |
| IUPAC name | [2-methyl-5-(1,3-thiazol-2-yl)phenyl]boronic acid |
| InChIKey | VIDCQZUAYXLDEZ-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)C2=NC=CS2)C)(O)O |
Computed by PubChem (NCBI)