CAS 1235973-94-0 is the registry number for (2,6-Difluoro-4-nitrophenyl)(methyl)sulfane, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
1,3-difluoro-2-methylsulfanyl-5-nitrobenzene (CAS 1235973-94-0) is a chemical compound with the molecular formula C7H5F2NO2S and a molecular weight of 205.18 g/mol. IUPAC name: 1,3-difluoro-2-methylsulfanyl-5-nitrobenzene. InChIKey: GWSBQXUBGJBRAP-UHFFFAOYSA-N.
| Molecular formula | C7H5F2NO2S |
|---|---|
| Molecular weight | 205.18 g/mol |
| IUPAC name | 1,3-difluoro-2-methylsulfanyl-5-nitrobenzene |
| InChIKey | GWSBQXUBGJBRAP-UHFFFAOYSA-N |
| SMILES | CSC1=C(C=C(C=C1F)[N+](=O)[O-])F |
Computed by PubChem (NCBI)