CAS 1236287-04-9 appears in our catalog under these names: Tenofovir maleate, Tenofovir maleate, Tenofovir (maleate). Offered by: GLPBio, Biosynth, MedChemExpress. Available pack sizes: 100mg, 25mg, Get quote.
[(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethylphosphonic acid;(Z)-but-2-enedioic acid (CAS 1236287-04-9) is a chemical compound with the molecular formula C13H18N5O8P and a molecular weight of 403.28 g/mol. IUPAC name: [(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethylphosphonic acid;(Z)-but-2-enedioic acid. InChIKey: OPQKUDVCYGLXAH-REVJHSINSA-N.
| Molecular formula | C13H18N5O8P |
|---|---|
| Molecular weight | 403.28 g/mol |
| IUPAC name | [(2R)-1-(6-aminopurin-9-yl)propan-2-yl]oxymethylphosphonic acid;(Z)-but-2-enedioic acid |
| InChIKey | OPQKUDVCYGLXAH-REVJHSINSA-N |
| SMILES | C[C@H](CN1C=NC2=C(N=CN=C21)N)OCP(=O)(O)O.C(=C\C(=O)O)\C(=O)O |
Computed by PubChem (NCBI)