CAS 1236566-87-2 is the registry number for N-(4-(((2,4-Diamino-6-pteridinyl)methyl)amino)benzoyl)glutamic Acid. Offered by: TRC. Available pack sizes: 100mg, 250mg, 25mg.
2-[[4-[(2,4-diaminopteridin-6-yl)methylamino]benzoyl]amino]pentanedioic acid (CAS 1236566-87-2) is a chemical compound with the molecular formula C19H20N8O5 and a molecular weight of 440.4 g/mol. IUPAC name: 2-[[4-[(2,4-diaminopteridin-6-yl)methylamino]benzoyl]amino]pentanedioic acid. InChIKey: TVZGACDUOSZQKY-UHFFFAOYSA-N.
| Molecular formula | C19H20N8O5 |
|---|---|
| Molecular weight | 440.4 g/mol |
| IUPAC name | 2-[[4-[(2,4-diaminopteridin-6-yl)methylamino]benzoyl]amino]pentanedioic acid |
| InChIKey | TVZGACDUOSZQKY-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)NC(CCC(=O)O)C(=O)O)NCC2=CN=C3C(=N2)C(=NC(=N3)N)N |
Computed by PubChem (NCBI)